| Product Name | 2-(2-Thiazolylazo)-p-cresol |
| CAS No. | 1823-44-5 |
| Synonyms | TAC; 4-Methyl-2-(2-thiazolylazo)-phenol; 4-methyl-6-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,4-dien-1-one; (6E)-4-methyl-6-[2-(1,3-thiazol-2-yl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
| InChI | InChI=1/C10H9N3OS/c1-7-2-3-9(14)8(6-7)12-13-10-11-4-5-15-10/h2-6H,1H3,(H,11,13)/b12-8+ |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.263 |
| Density | 1.357g/cm3 |
| Melting point | 127-130℃ |
| Boiling point | 464.649°C at 760 mmHg |
| Flash point | 234.812°C |
| Refractive index | 1.681 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1823-44-5 2-(2-thiazolylazo)-p-cresol
service@apichina.com