| Product Name | 2-(2-Pyridyl)ethylthiourea |
| CAS No. | 180403-26-3 |
| Synonyms | 1-(2-pyridin-2-ylethyl)thiourea |
| InChI | InChI=1/C8H11N3S/c9-8(12)11-6-4-7-3-1-2-5-10-7/h1-3,5H,4,6H2,(H3,9,11,12) |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.258 |
| Density | 1.212g/cm3 |
| Boiling point | 329.8°C at 760 mmHg |
| Flash point | 153.2°C |
| Refractive index | 1.626 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
180403-26-3 2-(2-pyridyl)ethylthiourea
service@apichina.com