| Product Name | 2-[2-(phenylthio)phenyl]acetic acid |
| CAS No. | 1527-17-9 |
| Synonyms | Acetic acid, (o-(phenylthio)phenyl)-; 2-(Phenylthio)benzeneacetic acid; BRN 2115692; Benzeneacetic acid, 2-(phenylthio)- (9CI); [2-(phenylsulfanyl)phenyl]acetic acid |
| InChI | InChI=1/C14H12O2S/c15-14(16)10-11-6-4-5-9-13(11)17-12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16) |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.3089 |
| Density | 1.27g/cm3 |
| Melting point | 116℃ |
| Boiling point | 396.3°C at 760 mmHg |
| Flash point | 193.5°C |
| Refractive index | 1.656 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1527-17-9 2-[2-(phenylthio)phenyl]acetic acid
service@apichina.com