| Product Name | 2-(2-naphthylthio)acetonitrile |
| CAS No. | 5324-69-6 |
| Synonyms | (naphthalen-2-ylsulfanyl)acetonitrile |
| InChI | InChI=1/C12H9NS/c13-7-8-14-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,8H2 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.2716 |
| Density | 1.2g/cm3 |
| Melting point | 83℃ |
| Boiling point | 374.8°C at 760 mmHg |
| Flash point | 180.5°C |
| Refractive index | 1.669 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
5324-69-6 2-(2-naphthylthio)acetonitrile
service@apichina.com