| Product Name | 2-(2-Methoxyethoxy)acetyl chloride |
| CAS No. | 16024-55-8 |
| Synonyms | (2-methoxyethoxy)acetyl chloride |
| InChI | InChI=1/C5H9ClO3/c1-8-2-3-9-4-5(6)7/h2-4H2,1H3 |
| Molecular Formula | C5H9ClO3 |
| Molecular Weight | 152.5762 |
| Density | 1.153g/cm3 |
| Boiling point | 183.7°C at 760 mmHg |
| Flash point | 73.7°C |
| Refractive index | 1.421 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
16024-55-8 2-(2-methoxyethoxy)acetyl chloride
service@apichina.com