| Product Name | 2-(2-hydroxyethyl)-3-methyl-1-oxo-1,5-dihydropyrido[1,2-a]benzimidazole-4-carbonitrile |
| CAS No. | 166671-26-7 |
| Synonyms | 2-(2-Hydroxyethyl)-3-methyl-1-oxo-1,5-dihydropyrido[1,2-a]benzimidazole-4-carbonitri |
| InChI | InChI=1/C15H13N3O2/c1-9-10(6-7-19)15(20)18-13-5-3-2-4-12(13)17-14(18)11(9)8-16/h2-5,17,19H,6-7H2,1H3 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.2826 |
| Density | 1.42g/cm3 |
| Melting point | 275℃ |
| Boiling point | 449°C at 760 mmHg |
| Flash point | 225.4°C |
| Refractive index | 1.695 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
166671-26-7 2-(2-hydroxyethyl)-3-methyl-1-oxo-1,5-dihydropyrido[1,2-a]benzimidazole-4-carbonitrile
service@apichina.com