| Product Name | 2-(2-Ethoxyphenoxy)ethyl bromide |
| CAS No. | 3259-03-8 |
| Synonyms | 2-(2-ethoxyphenoxy)bromide ethane; 5-(2-oxypropyl)-2-methoxybenzene sulphonamide; 1-(2-bromoethoxy)-2-ethoxybenzene; 2-(2-ethoxyphenoxy) bromide ethane |
| InChI | InChI=1/C10H13BrO2/c1-2-12-9-5-3-4-6-10(9)13-8-7-11/h3-6H,2,7-8H2,1H3 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.113 |
| Density | 1.334g/cm3 |
| Boiling point | 286.9°C at 760 mmHg |
| Flash point | 119.2°C |
| Refractive index | 1.528 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3259-03-8 2-(2-ethoxyphenoxy)ethyl bromide
service@apichina.com