| Product Name | 2,2-dimethyltetrahydropyrazine-1,4-diol |
| CAS No. | 118176-37-7 |
| Synonyms | 2,2-dimethylpiperazine-1,4-diol |
| InChI | InChI=1/C6H14N2O2/c1-6(2)5-7(9)3-4-8(6)10/h9-10H,3-5H2,1-2H3 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.1876 |
| Density | 1.208g/cm3 |
| Melting point | 174℃ |
| Boiling point | 269.7°C at 760 mmHg |
| Flash point | 144.2°C |
| Refractive index | 1.542 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
118176-37-7 2,2-dimethyltetrahydropyrazine-1,4-diol
service@apichina.com