| Product Name | 2,2-Dimethylglutaric anhydride |
| CAS No. | 2938-48-9 |
| Synonyms | 3,3-Dimethyldihydro-2H-pyran-2,6(3H)-dione |
| InChI | InChI=1/C7H10O3/c1-7(2)4-3-5(8)10-6(7)9/h3-4H2,1-2H3 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.1525 |
| Density | 1.102g/cm3 |
| Melting point | 35-39℃ |
| Boiling point | 267.1°C at 760 mmHg |
| Flash point | 104.9°C |
| Refractive index | 1.444 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
2938-48-9 2,2-dimethylglutaric anhydride
service@apichina.com