| Product Name | 2-(2-Dimethylaminoethyl)pyridine |
| CAS No. | 6304-27-4 |
| Synonyms | Pyridine, 2-(2-(dimethylamino)ethyl)-; 2-(2-(Dimethylamino)ethyl)pyridine; 2-(beta-(Dimethylamino)ethyl)pyridine; BRN 0121595; NSC 42626; 2-Pyridineethanamine, N,N-dimethyl- (9CI); N,N-Dimethylpyridine-2-ethylamine; N,N-dimethyl-2-(pyridin-2-yl)ethanamine |
| InChI | InChI=1/C9H14N2/c1-11(2)8-6-9-5-3-4-7-10-9/h3-5,7H,6,8H2,1-2H3 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.2209 |
| Density | 0.964g/cm3 |
| Boiling point | 214.8°C at 760 mmHg |
| Flash point | 83.7°C |
| Refractive index | 1.513 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
6304-27-4 2-(2-dimethylaminoethyl)pyridine
service@apichina.com