| Product Name | 2,2-difluoroethanol |
| CAS No. | 359-13-7 |
| Synonyms | Difluoroethanol; chloroacetyl fluoride |
| InChI | InChI=1/C2H2ClFO/c3-1-2(4)5/h1H2 |
| Molecular Formula | C2H2ClFO |
| Molecular Weight | 96.4881 |
| Density | 1.277g/cm3 |
| Boiling point | 109.2°C at 760 mmHg |
| Flash point | 19.8°C |
| Refractive index | 1.352 |
| Risk Codes | R11:Highly flammable.; R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
359-13-7 2,2-difluoroethanol
service@apichina.com