| Product Name | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid |
| CAS No. | 126120-85-2 |
| InChI | InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
| Molecular Formula | C8H4F2O4 |
| Molecular Weight | 202.1118 |
| Density | 1.66g/cm3 |
| Boiling point | 260.8°C at 760 mmHg |
| Flash point | 111.5°C |
| Refractive index | 1.561 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
126120-85-2 2,2-difluoro-1,3-benzodioxole-4-carboxylic acid
service@apichina.com