| Product Name | 2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride |
| CAS No. | 143096-86-0 |
| Synonyms | methyl tridecafluoroheptanoate; 2,2-difluoro-1,3-benzodioxole-4-carboxylate |
| InChI | InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12)/p-1 |
| Molecular Formula | C8H3F2O4 |
| Molecular Weight | 201.1044 |
| Boiling point | 260.8°C at 760 mmHg |
| Flash point | 111.5°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
143096-86-0 2,2-difluoro-1,3-benzodioxole-4-carbonyl chloride
service@apichina.com