| Product Name | 2,2-diethoxyethanol |
| CAS No. | 621-63-6 |
| Synonyms | Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
| InChI | InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.1736 |
| Density | 0.97g/cm3 |
| Boiling point | 167°C at 760 mmHg |
| Flash point | 68.4°C |
| Refractive index | 1.418 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
621-63-6 2,2-diethoxyethanol
service@apichina.com