| Product Name | 2,2-dichloroethanol |
| CAS No. | 598-38-9 |
| Synonyms | 2,2-Dichloroethanol; 4-01-00-01383 (Beilstein Handbook Reference); BRN 1731633; Dichloroethanol; NSC 60513; Ethanol, 2,2-dichloro- |
| InChI | InChI=1/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| Molecular Formula | C2H4Cl2O |
| Molecular Weight | 114.9586 |
| Density | 1.398g/cm3 |
| Boiling point | 146°C at 760 mmHg |
| Flash point | 78.3°C |
| Refractive index | 1.459 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R40:Possible risks of irreversible effects.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
598-38-9 2,2-dichloroethanol
service@apichina.com