| Product Name | 2,2-Dichlorocyclopropane-1-carboxylic acid |
| CAS No. | 5365-14-0 |
| Synonyms | (1S)-2,2-dichlorocyclopropanecarboxylate; (1R)-2,2-dichlorocyclopropanecarboxylate; 2,2-dichlorocyclopropanecarboxylic acid |
| InChI | InChI=1/C4H4Cl2O2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8) |
| Molecular Formula | C4H4Cl2O2 |
| Molecular Weight | 154.9794 |
| Density | 1.63g/cm3 |
| Melting point | 75℃ |
| Boiling point | 227.2°C at 760 mmHg |
| Flash point | 91.2°C |
| Refractive index | 1.539 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5365-14-0 2,2-dichlorocyclopropane-1-carboxylic acid
service@apichina.com