| Product Name | 2,2-Dibromo-1-indanone |
| CAS No. | 7749-02-2 |
| Synonyms | 2,2-Dibromo-1-indanone hydrate; 2,2-dibromo-2,3-dihydro-1H-inden-1-one |
| InChI | InChI=1/C9H6Br2O/c10-9(11)5-6-3-1-2-4-7(6)8(9)12/h1-4H,5H2 |
| Molecular Formula | C9H6Br2O |
| Molecular Weight | 289.9513 |
| Density | 2.039g/cm3 |
| Boiling point | 309.9°C at 760 mmHg |
| Flash point | 110.9°C |
| Refractive index | 1.684 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7749-02-2 2,2-dibromo-1-indanone
service@apichina.com