| Sales Email | Service@apichina.com |
| CAS No. | 26378-53-0 |
| Product Name | 2-(2-chlorophenoxy)ethylamine |
| Synonyms | 2-Chlorophenoxy-2-ethaneamine; 2-(2-chlorophenoxy)ethanamine |
| InChI | InChI=1/C8H10ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,5-6,10H2 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.6241 |
| Density | 1.178g/cm3 |
| Boiling point | 266.2°C at 760 mmHg |
| Flash point | 114.8°C |
| Refractive index | 1.544 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
