| Product Name | 2-(2-chlorophenoxy)ethanol |
| CAS No. | 15480-00-9 |
| Synonyms | Ethanol, 2-(2-chlorophenoxy)-; AI3-03886; 2-(2-Chlorophenoxy)ethanol |
| InChI | InChI=1/C8H9ClO2/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4,10H,5-6H2 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.6089 |
| Density | 1.238g/cm3 |
| Boiling point | 276.8°C at 760 mmHg |
| Flash point | 121.2°C |
| Refractive index | 1.543 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
15480-00-9 2-(2-chlorophenoxy)ethanol
service@apichina.com