| Product Name | 2-[(2-chlorobenzyl)oxy]-6-methoxybenzonitrile |
| CAS No. | 175204-02-1 |
| Synonyms | 2-[(2-Chlorobenzyl)oxy-6-methoxybenzonitrile |
| InChI | InChI=1/C15H12ClNO2/c1-18-14-7-4-8-15(12(14)9-17)19-10-11-5-2-3-6-13(11)16/h2-8H,10H2,1H3 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.7143 |
| Density | 1.26g/cm3 |
| Melting point | 152℃ |
| Boiling point | 447.7°C at 760 mmHg |
| Flash point | 224.6°C |
| Refractive index | 1.597 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175204-02-1 2-[(2-chlorobenzyl)oxy]-6-methoxybenzonitrile
service@apichina.com