| Product Name | 2-(2-Chloro-6-fluorobenzyl)-4,5-dichloropyridazine-3-(2H)-one |
| CAS No. | 175135-45-2 |
| Synonyms | 4,5-Dichloro-2-(2-chloro-6-fluorobenzyl)-2,3-dihydropyridazin-3-one; 4,5-dichloro-2-(2-chloro-6-fluorobenzyl)pyridazin-3(2H)-one |
| InChI | InChI=1/C11H6Cl3FN2O/c12-7-2-1-3-9(15)6(7)5-17-11(18)10(14)8(13)4-16-17/h1-4H,5H2 |
| Molecular Formula | C11H6Cl3FN2O |
| Molecular Weight | 307.5355 |
| Density | 1.56g/cm3 |
| Melting point | 137-138℃ |
| Boiling point | 362.7°C at 760 mmHg |
| Flash point | 173.2°C |
| Refractive index | 1.627 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175135-45-2 2-(2-chloro-6-fluorobenzyl)-4,5-dichloropyridazine-3-(2h)-one
service@apichina.com