| Product Name | 2-(2-Carboxyvinyl)benzeneboronic acid |
| CAS No. | 374105-86-9 |
| Synonyms | 2-Boronocinnamic acid; (2E)-3-[2-(dihydroxyboranyl)phenyl]prop-2-enoic acid |
| InChI | InChI=1/C9H9BO4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6,13-14H,(H,11,12)/b6-5+ |
| Molecular Formula | C9H9BO4 |
| Molecular Weight | 191.9764 |
| Density | 1.33g/cm3 |
| Boiling point | 447.1°C at 760 mmHg |
| Flash point | 224.2°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374105-86-9 2-(2-carboxyvinyl)benzeneboronic acid
service@apichina.com