| Product Name | 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
| CAS No. | 1171-47-7 |
| InChI | InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
| Molecular Formula | C7H11FO2 |
| Molecular Weight | 146.1594 |
| Density | 1.159g/cm3 |
| Boiling point | 227.566°C at 760 mmHg |
| Flash point | 91.429°C |
| Refractive index | 1.454 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1171-47-7 2,2-bis-(4-carboxyphenyl)-hexafluoropropane
service@apichina.com