| Product Name | 2-(2-amino-6-chloro-3-cyano-4H-chromen-4-yl)malononitrile |
| CAS No. | 175136-95-5 |
| Synonyms | (2-amino-6-chloro-3-cyano-4H-chromen-4-yl)propanedinitrile |
| InChI | InChI=1/C13H7ClN4O/c14-8-1-2-11-9(3-8)12(7(4-15)5-16)10(6-17)13(18)19-11/h1-3,7,12H,18H2 |
| Molecular Formula | C13H7ClN4O |
| Molecular Weight | 270.6739 |
| Density | 1.48g/cm3 |
| Melting point | 155℃ |
| Boiling point | 560°C at 760 mmHg |
| Flash point | 292.5°C |
| Refractive index | 1.65 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175136-95-5 2-(2-amino-6-chloro-3-cyano-4h-chromen-4-yl)malononitrile
service@apichina.com