| Product Name | 2-(2-amino-6,8-dibromo-3-cyano-4H-chromen-4-yl)malononitrile |
| CAS No. | 175136-96-6 |
| Synonyms | (2-amino-6,8-dibromo-3-cyano-4H-chromen-4-yl)propanedinitrile |
| InChI | InChI=1/C13H6Br2N4O/c14-7-1-8-11(6(3-16)4-17)9(5-18)13(19)20-12(8)10(15)2-7/h1-2,6,11H,19H2 |
| Molecular Formula | C13H6Br2N4O |
| Molecular Weight | 394.0209 |
| Density | 1.99g/cm3 |
| Melting point | 300℃ |
| Boiling point | 596.4°C at 760 mmHg |
| Flash point | 314.5°C |
| Refractive index | 1.711 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175136-96-6 2-(2-amino-6,8-dibromo-3-cyano-4h-chromen-4-yl)malononitrile
service@apichina.com