| Product Name | 2-(2,6-dichlorophenoxy)acetonitrile |
| CAS No. | 21244-78-0 |
| Synonyms | (2,6-dichlorophenoxy)acetonitrile |
| InChI | InChI=1/C8H5Cl2NO/c9-6-2-1-3-7(10)8(6)12-5-4-11/h1-3H,5H2 |
| Molecular Formula | C8H5Cl2NO |
| Molecular Weight | 202.0374 |
| Density | 1.372g/cm3 |
| Boiling point | 309°C at 760 mmHg |
| Flash point | 140.7°C |
| Refractive index | 1.555 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
21244-78-0 2-(2,6-dichlorophenoxy)acetonitrile
service@apichina.com