| Product Name | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
| CAS No. | 306937-38-2 |
| Synonyms | 2-(2,5-dimethylthiazol-4-yl)acetic acid; (2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
| InChI | InChI=1/C7H9NO2S/c1-4-6(3-7(9)10)8-5(2)11-4/h3H2,1-2H3,(H,9,10) |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.2169 |
| Density | 1.295g/cm3 |
| Melting point | 98℃ |
| Boiling point | 320.5°C at 760 mmHg |
| Flash point | 147.7°C |
| Refractive index | 1.572 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306937-38-2 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid
service@apichina.com