| Product Name | 2-(2,4-dichlorophenoxy)benzonitrile |
| CAS No. | 175136-80-8 |
| InChI | InChI=1/C13H7Cl2NO/c14-10-5-6-13(11(15)7-10)17-12-4-2-1-3-9(12)8-16/h1-7H |
| Molecular Formula | C13H7Cl2NO |
| Molecular Weight | 264.1068 |
| Density | 1.4g/cm3 |
| Melting point | 84℃ |
| Boiling point | 354.9°C at 760 mmHg |
| Flash point | 168.4°C |
| Refractive index | 1.633 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175136-80-8 2-(2,4-dichlorophenoxy)benzonitrile
service@apichina.com