| Product Name | 2-(2,4-Dichlorophenoxy)aniline hydrochloride |
| CAS No. | 89279-16-3 |
| InChI | InChI=1/C12H9Cl2NO.ClH/c13-8-5-6-11(9(14)7-8)16-12-4-2-1-3-10(12)15;/h1-7H,15H2;1H |
| Molecular Formula | C12H10Cl3NO |
| Molecular Weight | 290.5729 |
| Melting point | 88-91℃ |
| Boiling point | 332.8°C at 760 mmHg |
| Flash point | 155.1°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
89279-16-3 2-(2,4-dichlorophenoxy)aniline hydrochloride
service@apichina.com