| Product Name | 2-(2-{[(4-chlorophenyl)thio]methyl}phenoxy)ethanohydrazide |
| CAS No. | 175202-85-4 |
| Synonyms | 2-(2-[[(4-Chlorophenyl)thio]methyl]phenoxy)ethanohydrazide; 2-(2-{[(4-chlorophenyl)sulfanyl]methyl}phenoxy)acetohydrazide |
| InChI | InChI=1/C15H15ClN2O2S/c16-12-5-7-13(8-6-12)21-10-11-3-1-2-4-14(11)20-9-15(19)18-17/h1-8H,9-10,17H2,(H,18,19) |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.8098 |
| Density | 1.35g/cm3 |
| Melting point | 118℃ |
| Boiling point | 550.8°C at 760 mmHg |
| Flash point | 286.9°C |
| Refractive index | 1.652 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175202-85-4 2-(2-{[(4-chlorophenyl)thio]methyl}phenoxy)ethanohydrazide
service@apichina.com