| Product Name | 2-(2,4,5-Trichlorophenoxy)propionic acid |
| CAS No. | 93-72-1 |
| Synonyms | Silvex; tube; Fenoprop~Silvex; (2R)-2-(2,4,5-trichlorophenoxy)propanoic acid; (2S)-2-(2,4,5-trichlorophenoxy)propanoate; (2R)-2-(2,4,5-trichlorophenoxy)propanoate |
| InChI | InChI=1/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14)/p-1/t4-/m1/s1 |
| Molecular Formula | C9H6Cl3O3 |
| Molecular Weight | 268.5017 |
| Melting point | 177-181℃ |
| Boiling point | 378.4°C at 760 mmHg |
| Flash point | 182.6°C |
| Hazard Symbols |  Xn:Harmful;  N:Dangerous for the environment; |
| Risk Codes | R22:Harmful if swallowed.; R38:Irritating to skin.; R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S37:Wear suitable gloves.; S60:This material and its container must be disposed of as hazardous waste.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
93-72-1 2-(2,4,5-trichlorophenoxy)propionic acid
service@apichina.com