| Product Name | 2-(1-Pyrrolidino)phenol |
| CAS No. | 4787-77-3 |
| Synonyms | 2-Pyrrolidinophenol, [1-(2-Hydroxyphenyl)pyrrolidine]; 1-(2-Hydroxyphenyl)pyrrolidine; 2-pyrrolidin-1-ylphenol |
| InChI | InChI=1/C10H13NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h1-2,5-6,12H,3-4,7-8H2 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.2163 |
| Density | 1.146g/cm3 |
| Boiling point | 279.1°C at 760 mmHg |
| Flash point | 139.6°C |
| Refractive index | 1.594 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4787-77-3 2-(1-pyrrolidino)phenol
service@apichina.com