| Product Name | 2-(1-Piperazinyl)-3-pyridinecarbonitrile |
| CAS No. | 84951-44-0 |
| Synonyms | 1-(2-(3-Cyanopyridil))-piperazine; 2-Piperazinonicotinonitrile; 2-piperazin-1-ylpyridine-3-carbonitrile |
| InChI | InChI=1/C10H12N4/c11-8-9-2-1-3-13-10(9)14-6-4-12-5-7-14/h1-3,12H,4-7H2 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.2291 |
| Density | 1.22g/cm3 |
| Boiling point | 388°C at 760 mmHg |
| Flash point | 188.4°C |
| Refractive index | 1.605 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
84951-44-0 2-(1-piperazinyl)-3-pyridinecarbonitrile
service@apichina.com