| Product Name | 2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione |
| CAS No. | 499771-20-9 |
| Synonyms | 2-(morpholin-2-ylmethyl)-1H-isoindole-1,3(2H)-dione |
| InChI | InChI=1/C13H14N2O3/c16-12-10-3-1-2-4-11(10)13(17)15(12)8-9-7-14-5-6-18-9/h1-4,9,14H,5-8H2 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.2619 |
| Density | 1.297g/cm3 |
| Melting point | 141℃ |
| Boiling point | 407.7°C at 760 mmHg |
| Flash point | 200.4°C |
| Refractive index | 1.586 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
499771-20-9 2-(1,4-oxazinan-2-ylmethyl)-1h-isoindole-1,3(2h)-dione
service@apichina.com