| Product Name | 2-(1,3-Dioxolan-2-yl)-6-methylpyridine |
| CAS No. | 92765-75-8 |
| InChI | InChI=1/C9H11NO2/c1-7-3-2-4-8(10-7)9-11-5-6-12-9/h2-4,9H,5-6H2,1H3 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.143g/cm3 |
| Boiling point | 266.8°C at 760 mmHg |
| Flash point | 97.8°C |
| Refractive index | 1.526 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
92765-75-8 2-(1,3-dioxolan-2-yl)-6-methylpyridine
service@apichina.com