| Product Name | 2,1,3-benzoxadiazole-5-carbonyl chloride |
| CAS No. | 126147-86-2 |
| InChI | InChI=1/C7H3ClN2O2/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H |
| Molecular Formula | C7H3ClN2O2 |
| Molecular Weight | 182.5639 |
| Density | 1.531g/cm3 |
| Boiling point | 282.1°C at 760 mmHg |
| Flash point | 124.4°C |
| Refractive index | 1.637 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
126147-86-2 2,1,3-benzoxadiazole-5-carbonyl chloride
service@apichina.com