| Product Name | 2,1,3-Benzothiadiazole-4-carboxylic acid |
| CAS No. | 3529-57-5 |
| Synonyms | benzo[c][1,2,5]thiadiazole-4-carboxylic acid |
| InChI | InChI=1/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)9-12-8-5/h1-3H,(H,10,11) |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.1839 |
| Density | 1.609g/cm3 |
| Melting point | 145.5℃ |
| Boiling point | 368.748°C at 760 mmHg |
| Flash point | 176.813°C |
| Refractive index | 1.749 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3529-57-5 2,1,3-benzothiadiazole-4-carboxylic acid
service@apichina.com