| Product Name | 2,1,3-benzothiadiazol-4-yl isocyanate |
| CAS No. | 342411-14-7 |
| Synonyms | 4-isocyanato-2,1,3-benzothiadiazole |
| InChI | InChI=1/C7H3N3OS/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H |
| Molecular Formula | C7H3N3OS |
| Molecular Weight | 177.1832 |
| Density | 1.55g/cm3 |
| Melting point | 77℃ |
| Boiling point | 268.1°C at 760 mmHg |
| Flash point | 115.9°C |
| Refractive index | 1.772 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate
service@apichina.com