| Product Name | 2-({1-[3-(2-methoxy-10H-phenothiazin-10-yl)propyl]piperidin-4-yl}oxy)ethanol hydrochloride (1:1) |
| CAS No. | 40255-61-6 |
| InChI | InChI=1/C23H30N2O3S.ClH/c1-27-19-7-8-23-21(17-19)25(20-5-2-3-6-22(20)29-23)12-4-11-24-13-9-18(10-14-24)28-16-15-26;/h2-3,5-8,17-18,26H,4,9-16H2,1H3;1H |
| Molecular Formula | C23H31ClN2O3S |
| Molecular Weight | 451.0218 |
| Boiling point | 596.6°C at 760 mmHg |
| Flash point | 314.6°C |
40255-61-6 2-({1-[3-(2-methoxy-10h-phenothiazin-10-yl)propyl]piperidin-4-yl}oxy)ethanol hydrochlorid
service@apichina.com