| Product Name | (1S,2S)-(+)-2-Benzyloxycyclohexylamine |
| CAS No. | 216394-07-9 |
| Synonyms | (1S,2S)-(+)-1-Amino-2-benzyloxycyclohexane~(1S-trans)-(+)-2-(Phenylmethoxy)cyclohexanamine; (1S-trans)-2-(Phenylmethoxy)cyclohexaneamine; (1S,2S)-2-(benzyloxy)cyclohexanamine |
| InChI | InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m0/s1 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.2961 |
| Density | 1.039g/cm3 |
| Boiling point | 306.148°C at 760 mmHg |
| Flash point | 133.224°C |
| Refractive index | 1.545 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
216394-07-9 (1s,2s)-(+)-2-benzyloxycyclohexylamine
service@apichina.com