| Product Name | (1R)-(-)-Menthyl glyoxylate hydrate |
| CAS No. | 26315-61-7 |
| Synonyms | Glyoxylic acid (1R)-menthyl ester hydrate; (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl oxoacetate |
| InChI | InChI=1/C12H20O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h7-11H,4-6H2,1-3H3/t9-,10+,11-/m1/s1 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.2854 |
| Density | 1g/cm3 |
| Boiling point | 282°C at 760 mmHg |
| Flash point | 116.5°C |
| Refractive index | 1.458 |
| Risk Codes | R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
26315-61-7 (1r)-(-)-menthyl glyoxylate hydrate
service@apichina.com