| Product Name | (1R)-(-)-menthyl chloroformate |
| CAS No. | 14602-86-9;7635-53-2 |
| Synonyms | L-p-menth-3-yl chloroformate; Chloroformic acid (1R)-menthyl ester; L-Menthyl chloroformate; (1R)-(-)-menethyl chloroformate; 5-methyl-2-(propan-2-yl)cyclohexyl carbonochloridate; (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl chlorocarbonate; Carbonochloridic acid,(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester; Carbonochloridicacid, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-(1a,2b,5a)]-; (-)-(1R)-Menthyl chloroformate; (-)-(1R,2S,5R)-Menthyl chloroformate; (-)-(R)-Menthyl chloroformate; (-)-Menthyl chloroformate; (1R,2S,5R)-Menthylchloroformate; Chlorocarbonic acid (-)-menthyl ester; L-(-)-Menthylchloroformate; L-Menthoxy chloroformate; L-Menthyl chloroformate; Menthylchloroformate |
| InChI | InChI=1/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.7204 |
| Density | 1.04g/cm3 |
| Boiling point | 233.9°C at 760 mmHg |
| Flash point | 70°C |
| Refractive index | 1.462 |
| Risk Codes | R23:Toxic by inhalation.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
14602-86-9;7635-53-2 (1r)-(-)-menthyl chloroformate
service@apichina.com