| Product Name | (1R,2S)-(+)-2-Aminocyclohex-3-enecarboxylic acid hydrochloride |
| CAS No. | 131783-54-5 |
| Synonyms | (1R,2S)-2-aminocyclohex-3-ene-1-carboxylic acid hydrochloride; (1R,2S)-2-aminocyclohex-3-ene-1-carboxylic acid |
| InChI | InChI=1/C7H11NO2/c8-6-4-2-1-3-5(6)7(9)10/h2,4-6H,1,3,8H2,(H,9,10)/t5-,6+/m1/s1 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.1677 |
| Density | 1.18g/cm3 |
| Melting point | 190℃ |
| Boiling point | 285°C at 760 mmHg |
| Flash point | 126.2°C |
| Refractive index | 1.529 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
131783-54-5 (1r,2s)-(+)-2-aminocyclohex-3-enecarboxylic acid hydrochloride
service@apichina.com