| Product Name | 1H-Pyrazole-3-carboxylicacid, 5-methyl- |
| CAS No. | 402-61-9;696-22-0 |
| Synonyms | 3-methyl-1H-pyrazole-5-carboxylic acid; 5-Methyl-1H-pyrazole-3-carboxylic acid; 5-methylpyrazole-3-carboxylic acid |
| InChI | InChI=1/C5H6N2O2/c1-3-2-4(5(8)9)7-6-3/h2H,1H3,(H,6,7)(H,8,9) |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 |
| Density | 1.404 g/cm3 |
| Boiling point | 388.8 °C at 760 mmHg |
| Flash point | 188.9 °C |
| Refractive index | 1.595 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
402-61-9;696-22-0 1h-pyrazole-3-carboxylicacid, 5-methyl-
service@apichina.com