| Product Name | 1H-indole-7-carbohydrazide |
| CAS No. | 321309-24-4 |
| InChI | InChI=1/C9H9N3O/c10-12-9(13)7-3-1-2-6-4-5-11-8(6)7/h1-5,11H,10H2,(H,12,13) |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.1873 |
| Density | 1.353g/cm3 |
| Melting point | 177℃ |
| Refractive index | 1.719 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
321309-24-4 1h-indole-7-carbohydrazide
service@apichina.com