| Product Name | 1H-indol-3-ol |
| CAS No. | 480-93-3 |
| Synonyms | 3-Hydroxyindole; 1-Boc-1H-Indol-3-ol |
| InChI | InChI=1/C8H7NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1-5,9-10H |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
480-93-3 1h-indol-3-ol
service@apichina.com
- Next:480-94-4 3-mercaptoindole
- Previous:480-91-1 isoindolin-1-one