| Product Name | 1H-imidazole-4-carbothioamide |
| CAS No. | 95962-95-1 |
| Synonyms | 1H-imidazole-5-carbothioamide |
| InChI | InChI=1/C4H5N3S/c5-4(8)3-1-6-2-7-3/h1-2H,(H2,5,8)(H,6,7) |
| Molecular Formula | C4H5N3S |
| Molecular Weight | 127.1676 |
| Density | 1.452g/cm3 |
| Melting point | 204℃ |
| Boiling point | 420.7°C at 760 mmHg |
| Flash point | 208.3°C |
| Refractive index | 1.73 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
95962-95-1 1h-imidazole-4-carbothioamide
service@apichina.com