38460-95-6 10-undecenoyl chloride

Product Name	10-Undecenoyl chloride
CAS No.	38460-95-6
Synonyms	Undecenoylchloride; ; 10-Undeconyl chloride
InChI	InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2
Molecular Formula	C11H19ClO
Molecular Weight	202.72
Density	0.94
Boiling point	120-122℃ (10 torr)
Flash point	93℃
Refractive index	1.4532-1.4552
Hazard Symbols	C:Corrosive;
Risk Codes	R34:Causes burns.;
Safety	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;