| Product Name | 1-thio-beta-D-glucose tetraacetate |
| CAS No. | 19879-84-6 |
| Synonyms | 1-Thio-beta-D-glucose 2,3,4,6-tetraacetate; 2,3,4,6-tetra-O-acetyl-1-thio-beta-D-glucopyranose; 2,3,4,6-tetra-O-acetyl-1-thiohexopyranose |
| InChI | InChI=1/C14H20O9S/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18/h10-14,24H,5H2,1-4H3 |
| Molecular Formula | C14H20O9S |
| Molecular Weight | 364.3682 |
| Density | 1.31g/cm3 |
| Melting point | 115-117℃ |
| Boiling point | 425.5°C at 760 mmHg |
| Flash point | 298°C |
| Refractive index | 1.502 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
19879-84-6 1-thio-beta-d-glucose tetraacetate
service@apichina.com