| Product Name | 1-Piperidinethiocarboxamide |
| CAS No. | 14294-09-8 |
| Synonyms | piperidine-1-carbothioamide |
| InChI | InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.2379 |
| Density | 1.165g/cm3 |
| Boiling point | 237.3°C at 760 mmHg |
| Flash point | 97.3°C |
| Refractive index | 1.593 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
14294-09-8 1-piperidinethiocarboxamide
service@apichina.com